CAS 2055114-61-7 is the registry number for (3S,4R)-4-(3-Fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3S,4R)-4-(3-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxamide (CAS 2055114-61-7) is a chemical compound with the molecular formula C14H19FN2O2 and a molecular weight of 266.31 g/mol. IUPAC name: (3S,4R)-4-(3-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxamide. InChIKey: ARMXMGQJKGKYRH-QWHCGFSZSA-N.
| Molecular formula | C14H19FN2O2 |
|---|---|
| Molecular weight | 266.31 g/mol |
| IUPAC name | (3S,4R)-4-(3-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-3-carboxamide |
| InChIKey | ARMXMGQJKGKYRH-QWHCGFSZSA-N |
| SMILES | COCCN1C[C@H]([C@@H](C1)C(=O)N)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)