Products 122862-27-5
CAS 122862-27-5 is the registry number for N4-(1,3-Benzodioxol-5-ylmethyl)-6-chloro-2,4-pyrimidinediamine, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg.
4-N-(1,3-benzodioxol-5-ylmethyl)-6-chloropyrimidine-2,4-diamine (CAS 122862-27-5) is a chemical compound with the molecular formula C12H11ClN4O2 and a molecular weight of 278.69 g/mol. IUPAC name: 4-N-(1,3-benzodioxol-5-ylmethyl)-6-chloropyrimidine-2,4-diamine. InChIKey: VBHHPXQDJONCHR-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN4O2 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-chloropyrimidine-2,4-diamine |
| InChIKey | VBHHPXQDJONCHR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC3=CC(=NC(=N3)N)Cl |
Computed by PubChem (NCBI)