CAS 7460-27-7 is the registry number for 2-Chloro-N,6-dimethyl-5-nitro-N-phenylpyrimidin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N,6-dimethyl-5-nitro-N-phenylpyrimidin-4-amine (CAS 7460-27-7) is a chemical compound with the molecular formula C12H11ClN4O2 and a molecular weight of 278.69 g/mol. IUPAC name: 2-chloro-N,6-dimethyl-5-nitro-N-phenylpyrimidin-4-amine. InChIKey: JDGQVAOYUNHCNU-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN4O2 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | 2-chloro-N,6-dimethyl-5-nitro-N-phenylpyrimidin-4-amine |
| InChIKey | JDGQVAOYUNHCNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)N(C)C2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)