Products 1228631-03-5
CAS 1228631-03-5 is the registry number for tert-Butyl 4-(2,5-difluorobenzoyl)piperidine-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 10g.
Tert-butyl 4-(2,5-difluorobenzoyl)piperidine-1-carboxylate (CAS 1228631-03-5) is a chemical compound with the molecular formula C17H21F2NO3 and a molecular weight of 325.35 g/mol. IUPAC name: tert-butyl 4-(2,5-difluorobenzoyl)piperidine-1-carboxylate. InChIKey: HDKVTZXQVFRBIC-UHFFFAOYSA-N.
| Molecular formula | C17H21F2NO3 |
|---|---|
| Molecular weight | 325.35 g/mol |
| IUPAC name | tert-butyl 4-(2,5-difluorobenzoyl)piperidine-1-carboxylate |
| InChIKey | HDKVTZXQVFRBIC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)