CAS 948592-19-6 is the registry number for (S)-Methyl 3-(4,4-difluorocyclohexanecarboxamido)-3-phenylpropanoate. Offered by: TRC. Available pack sizes: 1g, 250mg, 5g.
Methyl (3S)-3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate (CAS 948592-19-6) is a chemical compound with the molecular formula C17H21F2NO3 and a molecular weight of 325.35 g/mol. IUPAC name: methyl (3S)-3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate. InChIKey: SFAUOZPRUQNOOT-AWEZNQCLSA-N.
| Molecular formula | C17H21F2NO3 |
|---|---|
| Molecular weight | 325.35 g/mol |
| IUPAC name | methyl (3S)-3-[(4,4-difluorocyclohexanecarbonyl)amino]-3-phenylpropanoate |
| InChIKey | SFAUOZPRUQNOOT-AWEZNQCLSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=CC=C1)NC(=O)C2CCC(CC2)(F)F |
Computed by PubChem (NCBI)