CAS 1228666-33-8 appears in our catalog under these names: 5-Bromo-2-pivalamidopyridin-4-yl pivalate, 95%, 5-Bromo-2-pivalamidopyridin-4-yl pivalate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
[5-bromo-2-(2,2-dimethylpropanoylamino)-4-pyridinyl] 2,2-dimethylpropanoate (CAS 1228666-33-8) is a chemical compound with the molecular formula C15H21BrN2O3 and a molecular weight of 357.24 g/mol. IUPAC name: [5-bromo-2-(2,2-dimethylpropanoylamino)-4-pyridinyl] 2,2-dimethylpropanoate. InChIKey: CZYFBLVXTCRMCV-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O3 |
|---|---|
| Molecular weight | 357.24 g/mol |
| IUPAC name | [5-bromo-2-(2,2-dimethylpropanoylamino)-4-pyridinyl] 2,2-dimethylpropanoate |
| InChIKey | CZYFBLVXTCRMCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C(=C1)OC(=O)C(C)(C)C)Br |
Computed by PubChem (NCBI)