Products 2866291-66-7
CAS 2866291-66-7 is the registry number for 4-Bromo-2-pivalamidopyridin-3-yl pivalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-bromo-2-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2,2-dimethylpropanoate (CAS 2866291-66-7) is a chemical compound with the molecular formula C15H21BrN2O3 and a molecular weight of 357.24 g/mol. IUPAC name: [4-bromo-2-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2,2-dimethylpropanoate. InChIKey: VQYRJOFEPMVQGU-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O3 |
|---|---|
| Molecular weight | 357.24 g/mol |
| IUPAC name | [4-bromo-2-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2,2-dimethylpropanoate |
| InChIKey | VQYRJOFEPMVQGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1OC(=O)C(C)(C)C)Br |
Computed by PubChem (NCBI)