CAS 1228666-61-2 is the registry number for 1-Pivaloyl-2,3-dihydro-1h-pyrido[2,3-b][1,4]-oxazine-6-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,2-dimethylpropanoyl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carbonitrile (CAS 1228666-61-2) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 1-(2,2-dimethylpropanoyl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carbonitrile. InChIKey: NDHZTAUNYPAJKE-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 1-(2,2-dimethylpropanoyl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-6-carbonitrile |
| InChIKey | NDHZTAUNYPAJKE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCOC2=C1C=CC(=N2)C#N |
Computed by PubChem (NCBI)