CAS 1228670-40-3 is the registry number for (E)-2-Fluoro-6-(pyrrolidin-1-yl)nicotinaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(NE)-N-[(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)methylidene]hydroxylamine (CAS 1228670-40-3) is a chemical compound with the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. IUPAC name: (NE)-N-[(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)methylidene]hydroxylamine. InChIKey: JQAZDWJJXUPEHW-KPKJPENVSA-N.
| Molecular formula | C10H12FN3O |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | (NE)-N-[(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)methylidene]hydroxylamine |
| InChIKey | JQAZDWJJXUPEHW-KPKJPENVSA-N |
| SMILES | C1CCN(C1)C2=NC(=C(C=C2)/C=N/O)F |
Computed by PubChem (NCBI)