CAS 1250903-02-6 appears in our catalog under these names: 1-(5-Amino-2-fluorophenyl)-1,3-diazinan-2-one, 95%, 1-(5-Amino-2-fluorophenyl)-1,3-diazinan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(5-amino-2-fluorophenyl)-1,3-diazinan-2-one (CAS 1250903-02-6) is a chemical compound with the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. IUPAC name: 1-(5-amino-2-fluorophenyl)-1,3-diazinan-2-one. InChIKey: BKOFAVGWOWQDAH-UHFFFAOYSA-N.
| Molecular formula | C10H12FN3O |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 1-(5-amino-2-fluorophenyl)-1,3-diazinan-2-one |
| InChIKey | BKOFAVGWOWQDAH-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=C(C=CC(=C2)N)F |
Computed by PubChem (NCBI)