CAS 1228678-63-4 is the registry number for Lithium 3-hydroxy-2,3-dihydro-1H-indene-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 3-hydroxy-2,3-dihydro-1H-indene-4-carboxylate (CAS 1228678-63-4) is a chemical compound with the molecular formula C10H9LiO3 and a molecular weight of 184.1 g/mol. IUPAC name: lithium 3-hydroxy-2,3-dihydro-1H-indene-4-carboxylate. InChIKey: LUGGWHCFMRUCIC-UHFFFAOYSA-M.
| Molecular formula | C10H9LiO3 |
|---|---|
| Molecular weight | 184.1 g/mol |
| IUPAC name | lithium 3-hydroxy-2,3-dihydro-1H-indene-4-carboxylate |
| InChIKey | LUGGWHCFMRUCIC-UHFFFAOYSA-M |
| SMILES | [Li+].C1CC2=C(C1O)C(=CC=C2)C(=O)[O-] |
Computed by PubChem (NCBI)