CAS 2418680-01-8 is the registry number for Lithium 2-phenyloxetane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Lithium 2-phenyloxetane-2-carboxylate (CAS 2418680-01-8) is a chemical compound with the molecular formula C10H9LiO3 and a molecular weight of 184.1 g/mol. IUPAC name: lithium 2-phenyloxetane-2-carboxylate. InChIKey: VDNSROTWQUTAGF-UHFFFAOYSA-M.
| Molecular formula | C10H9LiO3 |
|---|---|
| Molecular weight | 184.1 g/mol |
| IUPAC name | lithium 2-phenyloxetane-2-carboxylate |
| InChIKey | VDNSROTWQUTAGF-UHFFFAOYSA-M |
| SMILES | [Li+].C1COC1(C2=CC=CC=C2)C(=O)[O-] |
Computed by PubChem (NCBI)