CAS 1228880-04-3 appears in our catalog under these names: 1-(3-Methoxyphenyl)cyclobutan-1-amine hydrochloride, 1-(3-Methoxyphenyl)cyclobutan-1-amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 250mg, 1g.
1-(3-methoxyphenyl)cyclobutan-1-amine;hydrochloride (CAS 1228880-04-3) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 1-(3-methoxyphenyl)cyclobutan-1-amine;hydrochloride. InChIKey: IAADDGQTRVUTKB-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | IAADDGQTRVUTKB-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2(CCC2)N.Cl |
Computed by PubChem (NCBI)