Products 122894-73-9
CAS 122894-73-9 appears in our catalog under these names: Ethyl 2,3,4,5–Tetrafluorobenzoate, 2,3,4,5-Tetrafluorobenzoic acid ethyl ester, Ethyl 2,3,4,5-Tetrafluorobenzoate, >98.0%(GC), Ethyl 2,3,4,5-Tetrafluorobenzoate, 98%, 98%, 2,3,4,5-Tetrafluorobenzoic acid ethyl es, ter, 50 g. Offered by: GLPBio, Biosynth, TCI, Chemat, Roth. Available pack sizes: 100g, 10g, 25g, 0,25kg, 0,1kg, 0,5kg, 1kg, 500g.
Ethyl 2,3,4,5-tetrafluorobenzoate (CAS 122894-73-9) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: ethyl 2,3,4,5-tetrafluorobenzoate. InChIKey: SBHMXBYMQZRRLC-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | ethyl 2,3,4,5-tetrafluorobenzoate |
| InChIKey | SBHMXBYMQZRRLC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)