Products 1229114-66-2

CAS 1229114-66-2 is the registry number for Pioglitazone hydrochloride Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-sulfanylpropanoic acid (CAS 1229114-66-2) is a chemical compound with the molecular formula C18H21NO3S and a molecular weight of 331.4 g/mol. IUPAC name: 3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-sulfanylpropanoic acid. InChIKey: PZZPSEGSTMEYOI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21NO3S
Molecular weight331.4 g/mol
IUPAC name3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-sulfanylpropanoic acid
InChIKeyPZZPSEGSTMEYOI-UHFFFAOYSA-N
SMILESCCC1=CN=C(C=C1)CCOC2=CC=C(C=C2)CC(C(=O)O)S

Computed by PubChem (NCBI)