CAS 162698-41-1 is the registry number for (1-Benzhydrylazetidin-3-yl)methyl methanesulfonate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
(1-benzhydrylazetidin-3-yl)methyl methanesulfonate (CAS 162698-41-1) is a chemical compound with the molecular formula C18H21NO3S and a molecular weight of 331.4 g/mol. IUPAC name: (1-benzhydrylazetidin-3-yl)methyl methanesulfonate. InChIKey: JCOQDAJMCQWEAH-UHFFFAOYSA-N.
| Molecular formula | C18H21NO3S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (1-benzhydrylazetidin-3-yl)methyl methanesulfonate |
| InChIKey | JCOQDAJMCQWEAH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)