Products 122947-77-7

CAS 122947-77-7 is the registry number for Ponatinib Impurity 10. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(dibromomethyl)-4-nitro-2-(trifluoromethyl)benzene (CAS 122947-77-7) is a chemical compound with the molecular formula C8H4Br2F3NO2 and a molecular weight of 362.93 g/mol. IUPAC name: 1-(dibromomethyl)-4-nitro-2-(trifluoromethyl)benzene. InChIKey: PUSUNKYHBJJVAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Br2F3NO2
Molecular weight362.93 g/mol
IUPAC name1-(dibromomethyl)-4-nitro-2-(trifluoromethyl)benzene
InChIKeyPUSUNKYHBJJVAZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)C(Br)Br

Computed by PubChem (NCBI)