CAS 122947-77-7 is the registry number for Ponatinib Impurity 10. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-(dibromomethyl)-4-nitro-2-(trifluoromethyl)benzene (CAS 122947-77-7) is a chemical compound with the molecular formula C8H4Br2F3NO2 and a molecular weight of 362.93 g/mol. IUPAC name: 1-(dibromomethyl)-4-nitro-2-(trifluoromethyl)benzene. InChIKey: PUSUNKYHBJJVAZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F3NO2 |
|---|---|
| Molecular weight | 362.93 g/mol |
| IUPAC name | 1-(dibromomethyl)-4-nitro-2-(trifluoromethyl)benzene |
| InChIKey | PUSUNKYHBJJVAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)C(Br)Br |
Computed by PubChem (NCBI)