CAS 741737-02-0 is the registry number for 3,5-Dibromo-2-methoxy-6-(trifluoromethyl)isonicotinaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dibromo-2-methoxy-6-(trifluoromethyl)pyridine-4-carbaldehyde (CAS 741737-02-0) is a chemical compound with the molecular formula C8H4Br2F3NO2 and a molecular weight of 362.93 g/mol. IUPAC name: 3,5-dibromo-2-methoxy-6-(trifluoromethyl)pyridine-4-carbaldehyde. InChIKey: YFDFZJVJLCWFGH-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F3NO2 |
|---|---|
| Molecular weight | 362.93 g/mol |
| IUPAC name | 3,5-dibromo-2-methoxy-6-(trifluoromethyl)pyridine-4-carbaldehyde |
| InChIKey | YFDFZJVJLCWFGH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=N1)C(F)(F)F)Br)C=O)Br |
Computed by PubChem (NCBI)