Products 1229648-09-2

CAS 1229648-09-2 is the registry number for Rel-4-((1s,4r)-4-propylcyclohexyl)phenyl 4-methoxybenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[4-(4-propylcyclohexyl)phenyl] 4-methoxybenzoate (CAS 1229648-09-2) is a chemical compound with the molecular formula C23H28O3 and a molecular weight of 352.5 g/mol. IUPAC name: [4-(4-propylcyclohexyl)phenyl] 4-methoxybenzoate. InChIKey: LSVXFMRCYMRCNX-UHFFFAOYSA-N.

Identity
Molecular formulaC23H28O3
Molecular weight352.5 g/mol
IUPAC name[4-(4-propylcyclohexyl)phenyl] 4-methoxybenzoate
InChIKeyLSVXFMRCYMRCNX-UHFFFAOYSA-N
SMILESCCCC1CCC(CC1)C2=CC=C(C=C2)OC(=O)C3=CC=C(C=C3)OC

Computed by PubChem (NCBI)