Products 51895-51-3
CAS 51895-51-3 appears in our catalog under these names: Cannabinol Acetate, Cannabinol acetate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
(6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) acetate (CAS 51895-51-3) is a chemical compound with the molecular formula C23H28O3 and a molecular weight of 352.5 g/mol. IUPAC name: (6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) acetate. InChIKey: LCXOAMRAVSWHBP-UHFFFAOYSA-N.
| Molecular formula | C23H28O3 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | (6,6,9-trimethyl-3-pentylbenzo[c]chromen-1-yl) acetate |
| InChIKey | LCXOAMRAVSWHBP-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC2=C(C(=C1)OC(=O)C)C3=C(C=CC(=C3)C)C(O2)(C)C |
Computed by PubChem (NCBI)