CAS 1229653-15-9 is the registry number for 3–iodo–6,8–dimethoxy–4H–chromen–4–one. Offered by: GLPBio. Available pack sizes: 25mg.
3-iodo-6,8-dimethoxychromen-4-one (CAS 1229653-15-9) is a chemical compound with the molecular formula C11H9IO4 and a molecular weight of 332.09 g/mol. IUPAC name: 3-iodo-6,8-dimethoxychromen-4-one. InChIKey: CVWJYAKVANMGMI-UHFFFAOYSA-N.
| Molecular formula | C11H9IO4 |
|---|---|
| Molecular weight | 332.09 g/mol |
| IUPAC name | 3-iodo-6,8-dimethoxychromen-4-one |
| InChIKey | CVWJYAKVANMGMI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)OC=C(C2=O)I |
Computed by PubChem (NCBI)