CAS 187877-91-4 is the registry number for 3-Iodo-5,7-dimethoxy-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-5,7-dimethoxychromen-4-one (CAS 187877-91-4) is a chemical compound with the molecular formula C11H9IO4 and a molecular weight of 332.09 g/mol. IUPAC name: 3-iodo-5,7-dimethoxychromen-4-one. InChIKey: RBCVIDHIZFDMCR-UHFFFAOYSA-N.
| Molecular formula | C11H9IO4 |
|---|---|
| Molecular weight | 332.09 g/mol |
| IUPAC name | 3-iodo-5,7-dimethoxychromen-4-one |
| InChIKey | RBCVIDHIZFDMCR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C(=CO2)I |
Computed by PubChem (NCBI)