CAS 122999-39-7 appears in our catalog under these names: (S)-2-(Acetylthio)-4-methylpentanoic acid, 98%, (S)-2-(acetylthio)-4-methylpentanoic acid, 95%, 95%, (S)-2-(acetylthio)-4-methylpentanoic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2S)-2-acetylsulfanyl-4-methylpentanoic acid (CAS 122999-39-7) is a chemical compound with the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. IUPAC name: (2S)-2-acetylsulfanyl-4-methylpentanoic acid. InChIKey: JBFQRXOFTJJNEV-ZETCQYMHSA-N.
| Molecular formula | C8H14O3S |
|---|---|
| Molecular weight | 190.26 g/mol |
| IUPAC name | (2S)-2-acetylsulfanyl-4-methylpentanoic acid |
| InChIKey | JBFQRXOFTJJNEV-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)SC(=O)C |
Computed by PubChem (NCBI)