CAS 2866218-05-3 is the registry number for 2,2,5-Trimethyltetrahydro-4H-thiopyran-4-one 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,5-trimethyl-1,1-dioxothian-4-one (CAS 2866218-05-3) is a chemical compound with the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. IUPAC name: 2,2,5-trimethyl-1,1-dioxothian-4-one. InChIKey: UWCWEWIJIUAZJR-UHFFFAOYSA-N.
| Molecular formula | C8H14O3S |
|---|---|
| Molecular weight | 190.26 g/mol |
| IUPAC name | 2,2,5-trimethyl-1,1-dioxothian-4-one |
| InChIKey | UWCWEWIJIUAZJR-UHFFFAOYSA-N |
| SMILES | CC1CS(=O)(=O)C(CC1=O)(C)C |
Computed by PubChem (NCBI)