CAS 1230-77-9 is the registry number for DML3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[4-(dimethylamino)phenyl]-1-(4-methoxyphenyl)prop-2-en-1-one (CAS 1230-77-9) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (E)-3-[4-(dimethylamino)phenyl]-1-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: VYCHTZRFUNDXSN-AWNIVKPZSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (E)-3-[4-(dimethylamino)phenyl]-1-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | VYCHTZRFUNDXSN-AWNIVKPZSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)