CAS 123044-21-3 is the registry number for 4-Methyl-1h,2h,3h,5h,9bh-indeno[1,2-d]pyrimidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-methyl-3,9b-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione (CAS 123044-21-3) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 4-methyl-3,9b-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione. InChIKey: HBUKOEJGNRDGLW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-methyl-3,9b-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione |
| InChIKey | HBUKOEJGNRDGLW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(C3=CC=CC=C3C2=O)NC(=O)N1 |
Computed by PubChem (NCBI)