Products 123167-39-5
CAS 123167-39-5 appears in our catalog under these names: Arachidonic Acid–d5 methyl ester, Methyl arachidonate-d5. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 100 μg.
Methyl (5Z,8Z,11Z,14Z)-19,19,20,20,20-pentadeuterioicosa-5,8,11,14-tetraenoate (CAS 123167-39-5) is a chemical compound with the molecular formula C21H34O2 and a molecular weight of 323.5 g/mol. IUPAC name: methyl (5Z,8Z,11Z,14Z)-19,19,20,20,20-pentadeuterioicosa-5,8,11,14-tetraenoate. InChIKey: OFIDNKMQBYGNIW-ACEXYNNHSA-N.
| Molecular formula | C21H34O2 |
|---|---|
| Molecular weight | 323.5 g/mol |
| IUPAC name | methyl (5Z,8Z,11Z,14Z)-19,19,20,20,20-pentadeuterioicosa-5,8,11,14-tetraenoate |
| InChIKey | OFIDNKMQBYGNIW-ACEXYNNHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC |
Computed by PubChem (NCBI)