CAS 19245-55-7 appears in our catalog under these names: Arachidonic Acid–d8 methyl ester, Methyl arachidonate-d8, 99.9%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 500 μg (15.31 mM * 100 μL in Methyl acetate).
Methyl (5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoate (CAS 19245-55-7) is a chemical compound with the molecular formula C21H34O2 and a molecular weight of 326.5 g/mol. IUPAC name: methyl (5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoate. InChIKey: OFIDNKMQBYGNIW-SHGAEZPESA-N.
| Molecular formula | C21H34O2 |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | methyl (5Z,8Z,11Z,14Z)-5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoate |
| InChIKey | OFIDNKMQBYGNIW-SHGAEZPESA-N |
| SMILES | [2H]/C(=C(\[2H])/C/C(=C(/[2H])\C/C(=C(/[2H])\C/C(=C(/[2H])\CCCC(=O)OC)/[2H])/[2H])/[2H])/CCCCC |
Computed by PubChem (NCBI)