Products 123167-40-8
CAS 123167-40-8 appears in our catalog under these names: Hexanoic Acid-d5, Hexanoic-5,5,6,6,6-d5 Acid, 98 atom % D, min 98% Chemical Purity, Hexanoic Acid–d5. Offered by: TRC, CDN, GLPBio. Available pack sizes: 10mg, 50mg, 5mg, 0,25g, 0,1g, 25mg.
5,5,6,6,6-pentadeuteriohexanoic acid (CAS 123167-40-8) is a chemical compound with the molecular formula C6H12O2 and a molecular weight of 121.19 g/mol. IUPAC name: 5,5,6,6,6-pentadeuteriohexanoic acid. InChIKey: FUZZWVXGSFPDMH-ZBJDZAJPSA-N.
| Molecular formula | C6H12O2 |
|---|---|
| Molecular weight | 121.19 g/mol |
| IUPAC name | 5,5,6,6,6-pentadeuteriohexanoic acid |
| InChIKey | FUZZWVXGSFPDMH-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCCC(=O)O |
Computed by PubChem (NCBI)