Products 1276197-47-7
CAS 1276197-47-7 appears in our catalog under these names: Hexanoic-4,4,5,5,6,6,6-d7 Acid, Hexanoic-4,4,5,5,6,6,6-d7 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g.
4,4,5,5,6,6,6-heptadeuteriohexanoic acid (CAS 1276197-47-7) is a chemical compound with the molecular formula C6H12O2 and a molecular weight of 123.20 g/mol. IUPAC name: 4,4,5,5,6,6,6-heptadeuteriohexanoic acid. InChIKey: FUZZWVXGSFPDMH-NCKGIQLSSA-N.
| Molecular formula | C6H12O2 |
|---|---|
| Molecular weight | 123.20 g/mol |
| IUPAC name | 4,4,5,5,6,6,6-heptadeuteriohexanoic acid |
| InChIKey | FUZZWVXGSFPDMH-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5,6,6,6-heptadeuteriohexanoic acid