CAS 1231892-80-0 appears in our catalog under these names: 3-Amino-2-fluorophenylboronic Acid Pinacol Ester, 2–Fluoro–3–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)aniline, 2-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 96%, 2-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 96%, 96%, (3-Amino-2-fluorophenyl)boronic acid pinacol ester, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 1g, 5g, 250mg, 25g, 100mg, 10g.
2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1231892-80-0) is a chemical compound with the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. IUPAC name: 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: JQYPICYMRVGSCU-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | JQYPICYMRVGSCU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)N)F |
Computed by PubChem (NCBI)