CAS 123199-75-7 is the registry number for LY135305. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-naphthalen-1-yl-2-phenylpropan-1-amine;hydrochloride (CAS 123199-75-7) is a chemical compound with the molecular formula C19H20ClN and a molecular weight of 297.8 g/mol. IUPAC name: 3-naphthalen-1-yl-2-phenylpropan-1-amine;hydrochloride. InChIKey: POQHZWMHEOFWHT-UHFFFAOYSA-N.
| Molecular formula | C19H20ClN |
|---|---|
| Molecular weight | 297.8 g/mol |
| IUPAC name | 3-naphthalen-1-yl-2-phenylpropan-1-amine;hydrochloride |
| InChIKey | POQHZWMHEOFWHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC2=CC=CC3=CC=CC=C32)CN.Cl |
Computed by PubChem (NCBI)