CAS 163831-65-0 appears in our catalog under these names: (R)-N-Benzyl-1-(naphthalen-1-yl)ethanamine hydrochloride, 95%, Cinacalcet Impurity B HCl, (R)-N-Benzyl-1-(naphthalen-1-yl)ethanamine Hydrochloride, (R)-N-Benzyl-1-(naphthalen-1-yl)ethanamine hydrochloride 99+%, (R)-N-Benzyl-1-(naphthalen-1-yl)ethanamine hydrochloride, 99+%, 99+%. Offered by: Combi-blocks, Chemat Brand, Mikromol, Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 250mg, on request, 25mg, 2g, 5g.
(1R)-N-benzyl-1-naphthalen-1-ylethanamine;hydrochloride (CAS 163831-65-0) is a chemical compound with the molecular formula C19H20ClN and a molecular weight of 297.8 g/mol. IUPAC name: (1R)-N-benzyl-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: KCLJDAVYFCDIDY-XFULWGLBSA-N.
| Molecular formula | C19H20ClN |
|---|---|
| Molecular weight | 297.8 g/mol |
| IUPAC name | (1R)-N-benzyl-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | KCLJDAVYFCDIDY-XFULWGLBSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)NCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)