CAS 123310-66-7 is the registry number for 1-(4-(3-Chlorophenyl)thiazol-2-yl)guanidine Hydrobromide. Offered by: TRC. Available pack sizes: 2,5g.
2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide (CAS 123310-66-7) is a chemical compound with the molecular formula C10H10BrClN4S and a molecular weight of 333.64 g/mol. IUPAC name: 2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide. InChIKey: ICDIPUDZCOMAAA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClN4S |
|---|---|
| Molecular weight | 333.64 g/mol |
| IUPAC name | 2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]guanidine;hydrobromide |
| InChIKey | ICDIPUDZCOMAAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CSC(=N2)N=C(N)N.Br |
Computed by PubChem (NCBI)