CAS 1252197-38-8 is the registry number for N4-((4-Bromothiophen-2-yl)methyl)-6-chloro-N4-methylpyrimidine-2,4-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-[(4-bromothiophen-2-yl)methyl]-6-chloro-4-N-methylpyrimidine-2,4-diamine (CAS 1252197-38-8) is a chemical compound with the molecular formula C10H10BrClN4S and a molecular weight of 333.64 g/mol. IUPAC name: 4-N-[(4-bromothiophen-2-yl)methyl]-6-chloro-4-N-methylpyrimidine-2,4-diamine. InChIKey: NYACDQWXFXSIPJ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClN4S |
|---|---|
| Molecular weight | 333.64 g/mol |
| IUPAC name | 4-N-[(4-bromothiophen-2-yl)methyl]-6-chloro-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | NYACDQWXFXSIPJ-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CS1)Br)C2=CC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)