CAS 123324-87-8 is the registry number for 4-(1,1-Dimethylethyl)-N-(4-methylphenyl)benzenamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-(4-tert-butylphenyl)-4-methylaniline (CAS 123324-87-8) is a chemical compound with the molecular formula C17H21N and a molecular weight of 239.35 g/mol. IUPAC name: N-(4-tert-butylphenyl)-4-methylaniline. InChIKey: PPFUTRGZPQCEDA-UHFFFAOYSA-N.
| Molecular formula | C17H21N |
|---|---|
| Molecular weight | 239.35 g/mol |
| IUPAC name | N-(4-tert-butylphenyl)-4-methylaniline |
| InChIKey | PPFUTRGZPQCEDA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)