Products 611235-54-2
CAS 611235-54-2 is the registry number for 4-(4-tert-Butyl-cyclohex-1-enyl)benzonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
4-(4-tert-butylcyclohexen-1-yl)benzonitrile (CAS 611235-54-2) is a chemical compound with the molecular formula C17H21N and a molecular weight of 239.35 g/mol. IUPAC name: 4-(4-tert-butylcyclohexen-1-yl)benzonitrile. InChIKey: HGOVQAAGSNUFRH-UHFFFAOYSA-N.
| Molecular formula | C17H21N |
|---|---|
| Molecular weight | 239.35 g/mol |
| IUPAC name | 4-(4-tert-butylcyclohexen-1-yl)benzonitrile |
| InChIKey | HGOVQAAGSNUFRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(=CC1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)