CAS 123333-80-2 appears in our catalog under these names: SODIUM ACETATE-13C2-2-D3, 98 ATOM % 13C&, Sodium Acetate 13C2-d3, Sodium Acetate-13C2,D3. Offered by: Sigma-Aldrich, Chemat Brand, TRC. Available pack sizes: 500MG, on request, 2,5mg, 25mg.
Sodium 2,2,2-trideuterioacetate (CAS 123333-80-2) is a chemical compound with the molecular formula C2H3NaO2 and a molecular weight of 87.038 g/mol. IUPAC name: sodium 2,2,2-trideuterioacetate. InChIKey: VMHLLURERBWHNL-SZRYOQPCSA-M.
| Molecular formula | C2H3NaO2 |
|---|---|
| Molecular weight | 87.038 g/mol |
| IUPAC name | sodium 2,2,2-trideuterioacetate |
| InChIKey | VMHLLURERBWHNL-SZRYOQPCSA-M |
| SMILES | [2H][13C]([2H])([2H])[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)