CAS 85355-10-8 is the registry number for Sodium Acetate-13C, d3. Offered by: TRC. Available pack sizes: 100mg.
Sodium 2,2,2-trideuterioacetate (CAS 85355-10-8) is a chemical compound with the molecular formula C2H3NaO2 and a molecular weight of 86.045 g/mol. IUPAC name: sodium 2,2,2-trideuterioacetate. InChIKey: VMHLLURERBWHNL-SPZGMPHYSA-M.
| Molecular formula | C2H3NaO2 |
|---|---|
| Molecular weight | 86.045 g/mol |
| IUPAC name | sodium 2,2,2-trideuterioacetate |
| InChIKey | VMHLLURERBWHNL-SPZGMPHYSA-M |
| SMILES | [2H][13C]([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)