Products 123333-92-6

CAS 123333-92-6 appears in our catalog under these names: 2,3-Dimethylphenylhydrazine hydrochloride hydrate, 95%, 2,3–Dimethylphenylhydrazine hydrochloride hydrate, 2,3-Dimethylphenylhydrazine hydrochloride hydrate, (2,3-Dimethylphenyl)hydrazine hydrochloride xhydrate, 98%+,RG, 98%+,RG, 2,3-Dimethylphenylhydrazine hydrochloride hydrate, 98%+,RG. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 250g.

Structural formula: {0} (CAS {1})

(2,3-dimethylphenyl)hydrazine;hydrate;hydrochloride (CAS 123333-92-6) is a chemical compound with the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. IUPAC name: (2,3-dimethylphenyl)hydrazine;hydrate;hydrochloride. InChIKey: CWLHVQVBNFKKSG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClN2O
Molecular weight190.67 g/mol
IUPAC name(2,3-dimethylphenyl)hydrazine;hydrate;hydrochloride
InChIKeyCWLHVQVBNFKKSG-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)NN)C.O.Cl

Computed by PubChem (NCBI)