Products 1820707-48-9

CAS 1820707-48-9 is the registry number for Azetidin-3-yl(pyrrolidin-1-yl)methanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Azetidin-3-yl(pyrrolidin-1-yl)methanone;hydrochloride (CAS 1820707-48-9) is a chemical compound with the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. IUPAC name: azetidin-3-yl(pyrrolidin-1-yl)methanone;hydrochloride. InChIKey: RNWTYQZOFUOKNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClN2O
Molecular weight190.67 g/mol
IUPAC nameazetidin-3-yl(pyrrolidin-1-yl)methanone;hydrochloride
InChIKeyRNWTYQZOFUOKNQ-UHFFFAOYSA-N
SMILESC1CCN(C1)C(=O)C2CNC2.Cl

Computed by PubChem (NCBI)