Products 1233344-34-7
CAS 1233344-34-7 is the registry number for DHDPS-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (CAS 1233344-34-7) is a chemical compound with the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. IUPAC name: 2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid. InChIKey: VMHLNIJHJPIPKG-POHAHGRESA-N.
| Molecular formula | C13H11NO5S |
|---|---|
| Molecular weight | 293.30 g/mol |
| IUPAC name | 2-[(5Z)-5-[(4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| InChIKey | VMHLNIJHJPIPKG-POHAHGRESA-N |
| SMILES | COC1=CC=C(C=C1)/C=C\2/C(=O)N(C(=O)S2)CC(=O)O |
Computed by PubChem (NCBI)