CAS 1233693-22-5 is the registry number for 3,4-Bis(tert-butoxycarbonylamino)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1233693-22-5) is a chemical compound with the molecular formula C16H25BN2O6 and a molecular weight of 352.2 g/mol. IUPAC name: [3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: OLHUPXIXFDSXGK-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O6 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | [3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | OLHUPXIXFDSXGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)