CAS 2377608-52-9 is the registry number for 1-BOC-3-(Methoxycarbonyl)-1H-pyrazole-5-boronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-O-tert-butyl 3-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1,3-dicarboxylate (CAS 2377608-52-9) is a chemical compound with the molecular formula C16H25BN2O6 and a molecular weight of 352.2 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1,3-dicarboxylate. InChIKey: IWNIJQFWJIIZKQ-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O6 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1,3-dicarboxylate |
| InChIKey | IWNIJQFWJIIZKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN2C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)