CAS 1233860-02-0 is the registry number for (S)-tert-Butyl (1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl)carbamate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[(3S)-1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamate (CAS 1233860-02-0) is a chemical compound with the molecular formula C15H22FN3O2 and a molecular weight of 295.35 g/mol. IUPAC name: tert-butyl N-[(3S)-1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamate. InChIKey: TZVULHTYGHKPMR-NSHDSACASA-N.
| Molecular formula | C15H22FN3O2 |
|---|---|
| Molecular weight | 295.35 g/mol |
| IUPAC name | tert-butyl N-[(3S)-1-(2-amino-4-fluorophenyl)pyrrolidin-3-yl]carbamate |
| InChIKey | TZVULHTYGHKPMR-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C1)C2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)