CAS 154590-35-9 is the registry number for 4-(4-Boc-piperazin-1-yl)-3-fluoroaniline, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl 4-(4-amino-2-fluorophenyl)piperazine-1-carboxylate (CAS 154590-35-9) is a chemical compound with the molecular formula C15H22FN3O2 and a molecular weight of 295.35 g/mol. IUPAC name: tert-butyl 4-(4-amino-2-fluorophenyl)piperazine-1-carboxylate. InChIKey: IULXQAJBODFBAK-UHFFFAOYSA-N.
| Molecular formula | C15H22FN3O2 |
|---|---|
| Molecular weight | 295.35 g/mol |
| IUPAC name | tert-butyl 4-(4-amino-2-fluorophenyl)piperazine-1-carboxylate |
| InChIKey | IULXQAJBODFBAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)