CAS 1233967-22-0 appears in our catalog under these names: 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone, 95%, 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone, 95%, 95%, 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-(2-amino-5-bromophenyl)-2,2,2-trifluoroethanone (CAS 1233967-22-0) is a chemical compound with the molecular formula C8H5BrF3NO and a molecular weight of 268.03 g/mol. IUPAC name: 1-(2-amino-5-bromophenyl)-2,2,2-trifluoroethanone. InChIKey: CWTOSTWUQONVEW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO |
|---|---|
| Molecular weight | 268.03 g/mol |
| IUPAC name | 1-(2-amino-5-bromophenyl)-2,2,2-trifluoroethanone |
| InChIKey | CWTOSTWUQONVEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)