Products 1448790-49-5
CAS 1448790-49-5 is the registry number for 1-(5-Bromo-3-methylpyridin-2-yl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-(5-bromo-3-methyl-2-pyridinyl)-2,2,2-trifluoroethanone (CAS 1448790-49-5) is a chemical compound with the molecular formula C8H5BrF3NO and a molecular weight of 268.03 g/mol. IUPAC name: 1-(5-bromo-3-methyl-2-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: GAEMFGMGYFLFCL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO |
|---|---|
| Molecular weight | 268.03 g/mol |
| IUPAC name | 1-(5-bromo-3-methyl-2-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | GAEMFGMGYFLFCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)