CAS 1234-21-5 is the registry number for 1,3-Bis(3-nitrophenyl)urea, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1,3-bis(3-nitrophenyl)urea (CAS 1234-21-5) is a chemical compound with the molecular formula C13H10N4O5 and a molecular weight of 302.24 g/mol. IUPAC name: 1,3-bis(3-nitrophenyl)urea. InChIKey: LMGCNSZBVIPYHM-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O5 |
|---|---|
| Molecular weight | 302.24 g/mol |
| IUPAC name | 1,3-bis(3-nitrophenyl)urea |
| InChIKey | LMGCNSZBVIPYHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)