Products 123437-24-1
CAS 123437-24-1 is the registry number for Coelenterazine P. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-methylpropyl)imidazo[1,2-a]pyrazin-3-ol (CAS 123437-24-1) is a chemical compound with the molecular formula C23H23N3O3 and a molecular weight of 389.4 g/mol. IUPAC name: 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-methylpropyl)imidazo[1,2-a]pyrazin-3-ol. InChIKey: LEHROKGQGAHTOM-UHFFFAOYSA-N.
| Molecular formula | C23H23N3O3 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-methylpropyl)imidazo[1,2-a]pyrazin-3-ol |
| InChIKey | LEHROKGQGAHTOM-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NC(=CN2C1=NC(=C2O)CC3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)
Synonyms:
Coelenterazine p